CAS 1212921-46-4 appears in our catalog under these names: Boc-d-4-acetylphe, 98%, (R)-3-(4-Acetylphenyl)-2-((tert-butoxycarbonyl)amino)propanoic acid, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg.
(2R)-3-(4-acetylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1212921-46-4) is a chemical compound with the molecular formula C16H21NO5 and a molecular weight of 307.34 g/mol. IUPAC name: (2R)-3-(4-acetylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: YVBRFBNRDRVUAF-CYBMUJFWSA-N.
| Molecular formula | C16H21NO5 |
|---|---|
| Molecular weight | 307.34 g/mol |
| IUPAC name | (2R)-3-(4-acetylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | YVBRFBNRDRVUAF-CYBMUJFWSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)