cas: 790668-06-3 — see every product listed under this CAS number, including other names
(2R,4S)-tert-Butyl 4-hydroxy-2-methylpiperidine-1-carboxylate 97% (CAS 790668-06-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A140854-100mg |
| cas | 790668-06-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 670.75 Pln | |
| Ambeed | 5g | 2089.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A140854 |
Tert-butyl (2R,4S)-4-hydroxy-2-methylpiperidine-1-carboxylate (CAS 790668-06-3) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl (2R,4S)-4-hydroxy-2-methylpiperidine-1-carboxylate. InChIKey: RCXJVQLRZJXWNM-BDAKNGLRSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl (2R,4S)-4-hydroxy-2-methylpiperidine-1-carboxylate |
| InChIKey | RCXJVQLRZJXWNM-BDAKNGLRSA-N |
| SMILES | C[C@@H]1C[C@H](CCN1C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)