(2R,5R)-1-Hydroxy-2,5-diphenylphospholane 1-oxide, 98%
cas: 226393-33-5 — see every product listed under this CAS number, including other names
(2R,5R)-1-Hydroxy-2,5-diphenylphospholane 1-oxide, 98% (CAS 226393-33-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1326423-100mg |
| cas | 226393-33-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 731.94 Pln | |
| Ambeed | 5g | 3374.12 Pln | |
| BLDpharm | 100mg | 281.04 Pln | |
| BLDpharm | 250mg | 325.47 Pln | |
| BLDpharm | 1g | 780.86 Pln | |
| BLDpharm | 5g | 3629.86 Pln | |
| Chemat | 100mg | 400.40 Pln | |
| Chemat | 250mg | 640.40 Pln | |
| Chemat | 1g | 1614.80 Pln | |
| Chemat | 5g | 5493.20 Pln | |
| Fluorochem | 250mg | 1174.60 Pln | |
| Fluorochem | 1g | 3007.29 Pln | |
| Fluorochem | 5g | 10015.24 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2R,5R)-1-hydroxy-2,5-diphenyl-1lambda5-phospholane 1-oxide (CAS 226393-33-5) is a chemical compound with the molecular formula C16H17O2P and a molecular weight of 272.28 g/mol. IUPAC name: (2R,5R)-1-hydroxy-2,5-diphenyl-1lambda5-phospholane 1-oxide. InChIKey: JXBQOEHGCNDFQE-HZPDHXFCSA-N.
| Molecular formula | C16H17O2P |
|---|---|
| Molecular weight | 272.28 g/mol |
| IUPAC name | (2R,5R)-1-hydroxy-2,5-diphenyl-1lambda5-phospholane 1-oxide |
| InChIKey | JXBQOEHGCNDFQE-HZPDHXFCSA-N |
| SMILES | C1C[C@@H](P(=O)([C@H]1C2=CC=CC=C2)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)