CAS 226393-51-7 is the registry number for rel-(2R,5R)-1-hydroxy-2,5-diphenylphospholane 1-oxide, 98%. Offered by: AmBeed. Available pack sizes: 5g.
(2R,5R)-1-hydroxy-2,5-diphenyl-1lambda5-phospholane 1-oxide (CAS 226393-51-7) is a chemical compound with the molecular formula C16H17O2P and a molecular weight of 272.28 g/mol. IUPAC name: (2R,5R)-1-hydroxy-2,5-diphenyl-1lambda5-phospholane 1-oxide. InChIKey: JXBQOEHGCNDFQE-HZPDHXFCSA-N.
| Molecular formula | C16H17O2P |
|---|---|
| Molecular weight | 272.28 g/mol |
| IUPAC name | (2R,5R)-1-hydroxy-2,5-diphenyl-1lambda5-phospholane 1-oxide |
| InChIKey | JXBQOEHGCNDFQE-HZPDHXFCSA-N |
| SMILES | C1C[C@@H](P(=O)([C@H]1C2=CC=CC=C2)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)