cas: 1639886-52-4 — see every product listed under this CAS number, including other names
(2R,5R)-2,5-Dimethylmorpholine hydrochloride, 97% (CAS 1639886-52-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F690144-100MG |
| cas | 1639886-52-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 310.33 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2R,5R)-2,5-dimethylmorpholine;hydrochloride (CAS 1639886-52-4) is a chemical compound with the molecular formula C6H14ClNO and a molecular weight of 151.63 g/mol. IUPAC name: (2R,5R)-2,5-dimethylmorpholine;hydrochloride. InChIKey: UIHUHFHYLUKRBX-KGZKBUQUSA-N.
| Molecular formula | C6H14ClNO |
|---|---|
| Molecular weight | 151.63 g/mol |
| IUPAC name | (2R,5R)-2,5-dimethylmorpholine;hydrochloride |
| InChIKey | UIHUHFHYLUKRBX-KGZKBUQUSA-N |
| SMILES | C[C@@H]1CN[C@@H](CO1)C.Cl |
Computed by PubChem (NCBI)