CAS 135295-27-1 appears in our catalog under these names: (2RS)-FPMPA/ 99.9%, (2RS)-FPMPA. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg, 1 mg, 10 mg.
[1-(6-aminopurin-9-yl)-3-fluoropropan-2-yl]oxymethylphosphonic acid (CAS 135295-27-1) is a chemical compound with the molecular formula C9H13FN5O4P and a molecular weight of 305.20 g/mol. IUPAC name: [1-(6-aminopurin-9-yl)-3-fluoropropan-2-yl]oxymethylphosphonic acid. InChIKey: BFZJTDBFUROXJA-UHFFFAOYSA-N.
| Molecular formula | C9H13FN5O4P |
|---|---|
| Molecular weight | 305.20 g/mol |
| IUPAC name | [1-(6-aminopurin-9-yl)-3-fluoropropan-2-yl]oxymethylphosphonic acid |
| InChIKey | BFZJTDBFUROXJA-UHFFFAOYSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)CC(CF)OCP(=O)(O)O)N |
Computed by PubChem (NCBI)