cas: 1858273-09-2 — see every product listed under this CAS number, including other names
(2S)-1-Amino-3-(1,2,3,4-tetrahydroisoquinolin-2-yl)propan-2-ol hydrochloride, 98%, 98% (CAS 1858273-09-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FW80-100mg |
| cas | 1858273-09-2 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 10g | 683.60 Pln | |
| Chemat | 25g | 1096.40 Pln | |
| Chemat | 50g | 1782.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-1-amino-3-(3,4-dihydro-1H-isoquinolin-2-yl)propan-2-ol;hydrochloride (CAS 1858273-09-2) is a chemical compound with the molecular formula C12H19ClN2O and a molecular weight of 242.74 g/mol. IUPAC name: (2S)-1-amino-3-(3,4-dihydro-1H-isoquinolin-2-yl)propan-2-ol;hydrochloride. InChIKey: LMOPTTOPZZOIBU-YDALLXLXSA-N.
| Molecular formula | C12H19ClN2O |
|---|---|
| Molecular weight | 242.74 g/mol |
| IUPAC name | (2S)-1-amino-3-(3,4-dihydro-1H-isoquinolin-2-yl)propan-2-ol;hydrochloride |
| InChIKey | LMOPTTOPZZOIBU-YDALLXLXSA-N |
| SMILES | C1CN(CC2=CC=CC=C21)C[C@H](CN)O.Cl |
Computed by PubChem (NCBI)