cas: 1858273-09-2 — see every product listed under this CAS number, including other names
(S)-1-Amino-3-(3,4-dihydroisoquinolin-2(1H)-yl)propan-2-ol hydrochloride 95% (CAS 1858273-09-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A675044-100mg |
| cas | 1858273-09-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 214.62 Pln | |
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 1299.31 Pln | |
| Ambeed | 25g | 4380.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A675044 |
(2S)-1-amino-3-(3,4-dihydro-1H-isoquinolin-2-yl)propan-2-ol;hydrochloride (CAS 1858273-09-2) is a chemical compound with the molecular formula C12H19ClN2O and a molecular weight of 242.74 g/mol. IUPAC name: (2S)-1-amino-3-(3,4-dihydro-1H-isoquinolin-2-yl)propan-2-ol;hydrochloride. InChIKey: LMOPTTOPZZOIBU-YDALLXLXSA-N.
| Molecular formula | C12H19ClN2O |
|---|---|
| Molecular weight | 242.74 g/mol |
| IUPAC name | (2S)-1-amino-3-(3,4-dihydro-1H-isoquinolin-2-yl)propan-2-ol;hydrochloride |
| InChIKey | LMOPTTOPZZOIBU-YDALLXLXSA-N |
| SMILES | C1CN(CC2=CC=CC=C21)C[C@H](CN)O.Cl |
Computed by PubChem (NCBI)