cas: 2350460-04-5 — see every product listed under this CAS number, including other names
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(1-methylcyclohexyl)acetic acid, 98%, 98% (CAS 2350460-04-5) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1F6LMK-1mg |
| cas | 2350460-04-5 |
| size | 1mg |
| availability | 1.25g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 333.20 Pln | |
| Chemat | 5mg | 750.80 Pln | |
| Chemat | 10mg | 1168.40 Pln | |
| Chemat | 25mg | 2162.00 Pln | |
| Chemat | 50mg | 3635.60 Pln | |
| Chemat | 100mg | 6131.60 Pln | |
| Chemat | 250mg | 12203.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(1-methylcyclohexyl)acetic acid (CAS 2350460-04-5) is a chemical compound with the molecular formula C24H27NO4 and a molecular weight of 393.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(1-methylcyclohexyl)acetic acid. InChIKey: IFIPWXDCTFSSKZ-OAQYLSRUSA-N.
| Molecular formula | C24H27NO4 |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(1-methylcyclohexyl)acetic acid |
| InChIKey | IFIPWXDCTFSSKZ-OAQYLSRUSA-N |
| SMILES | CC1(CCCCC1)[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)