cas: 1421697-46-2 — see every product listed under this CAS number, including other names
(2S)-2-[[[[(1S,2S)-2-Aminocyclohexyl]amino]thioxomethyl]amino]-N-(diphenylmethyl)-N,3,3-trimethylbutanamide, 95% (CAS 1421697-46-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch112HVW-50mg |
| cas | 1421697-46-2 |
| size | 50mg |
| availability | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 318.80 Pln | |
| Chemat | 100mg | 419.60 Pln | |
| Chemat | 250mg | 760.40 Pln | |
| Chemat | 1g | 2162.00 Pln | |
| Fluorochem | 50mg | 414.46 Pln | |
| Fluorochem | 100mg | 430.07 Pln | |
| Fluorochem | 250mg | 804.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[[(1S,2S)-2-aminocyclohexyl]carbamothioylamino]-N-benzhydryl-N,3,3-trimethylbutanamide (CAS 1421697-46-2) is a chemical compound with the molecular formula C27H38N4OS and a molecular weight of 466.7 g/mol. IUPAC name: (2S)-2-[[(1S,2S)-2-aminocyclohexyl]carbamothioylamino]-N-benzhydryl-N,3,3-trimethylbutanamide. InChIKey: SBIFZNWYUGRUDF-WPFOTENUSA-N.
| Molecular formula | C27H38N4OS |
|---|---|
| Molecular weight | 466.7 g/mol |
| IUPAC name | (2S)-2-[[(1S,2S)-2-aminocyclohexyl]carbamothioylamino]-N-benzhydryl-N,3,3-trimethylbutanamide |
| InChIKey | SBIFZNWYUGRUDF-WPFOTENUSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)N(C)C(C1=CC=CC=C1)C2=CC=CC=C2)NC(=S)N[C@H]3CCCC[C@@H]3N |
Computed by PubChem (NCBI)