Products 874945-79-6
CAS 874945-79-6 appears in our catalog under these names: 9-Anthraceneethanol, b-amino-, (bS)-, 97%, (2S)-2-AMINO-2-(ANTHRACEN-9-YL)ETHAN-1-OL, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-amino-2-anthracen-9-ylethanol (CAS 874945-79-6) is a chemical compound with the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. IUPAC name: (2S)-2-amino-2-anthracen-9-ylethanol. InChIKey: ZNTMTJISNMWNMS-OAHLLOKOSA-N.
| Molecular formula | C16H15NO |
|---|---|
| Molecular weight | 237.30 g/mol |
| IUPAC name | (2S)-2-amino-2-anthracen-9-ylethanol |
| InChIKey | ZNTMTJISNMWNMS-OAHLLOKOSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2[C@@H](CO)N |
Computed by PubChem (NCBI)
Synonyms:
(S)-2-Amino-2-(anthracen-9-yl)ethan-1-ol