Products 2378000-02-1
CAS 2378000-02-1 is the registry number for 1-([1,1'-Biphenyl]-3-yl)pyrrolidin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-phenylphenyl)pyrrolidin-2-one (CAS 2378000-02-1) is a chemical compound with the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. IUPAC name: 1-(3-phenylphenyl)pyrrolidin-2-one. InChIKey: WKCAUOFGICVHOL-UHFFFAOYSA-N.
| Molecular formula | C16H15NO |
|---|---|
| Molecular weight | 237.30 g/mol |
| IUPAC name | 1-(3-phenylphenyl)pyrrolidin-2-one |
| InChIKey | WKCAUOFGICVHOL-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2=CC=CC(=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)