cas: 10148-70-6 — see every product listed under this CAS number, including other names
(2S,3S)-2-Amino-3-hydroxy-4-methylpentanoic acid, 95%, 95% (CAS 10148-70-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1115L7-100mg |
| cas | 10148-70-6 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1528.40 Pln | |
| Chemat | 250mg | 3290.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S,3S)-2-amino-3-hydroxy-4-methylpentanoic acid (CAS 10148-70-6) is a chemical compound with the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. IUPAC name: (2S,3S)-2-amino-3-hydroxy-4-methylpentanoic acid. InChIKey: ZAYJDMWJYCTABM-WHFBIAKZSA-N.
| Molecular formula | C6H13NO3 |
|---|---|
| Molecular weight | 147.17 g/mol |
| IUPAC name | (2S,3S)-2-amino-3-hydroxy-4-methylpentanoic acid |
| InChIKey | ZAYJDMWJYCTABM-WHFBIAKZSA-N |
| SMILES | CC(C)[C@@H]([C@@H](C(=O)O)N)O |
Computed by PubChem (NCBI)