cas: 6730-10-5 — see every product listed under this CAS number, including other names
(2S,3S,4R,5S,6R)-3-Acetamido-6-(acetoxymethyl)tetrahydro-2H-pyran-2,4,5-triyl triacetate 97% (CAS 6730-10-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A541217-100mg |
| cas | 6730-10-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 637.38 Pln | |
| Ambeed | 5g | 2089.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A541217 |
[(2R,3S,4R,5S,6S)-5-acetamido-3,4,6-triacetyloxyoxan-2-yl]methyl acetate (CAS 6730-10-5) is a chemical compound with the molecular formula C16H23NO10 and a molecular weight of 389.35 g/mol. IUPAC name: [(2R,3S,4R,5S,6S)-5-acetamido-3,4,6-triacetyloxyoxan-2-yl]methyl acetate. InChIKey: OVPIZHVSWNOZMN-YIDVYQOGSA-N.
| Molecular formula | C16H23NO10 |
|---|---|
| Molecular weight | 389.35 g/mol |
| IUPAC name | [(2R,3S,4R,5S,6S)-5-acetamido-3,4,6-triacetyloxyoxan-2-yl]methyl acetate |
| InChIKey | OVPIZHVSWNOZMN-YIDVYQOGSA-N |
| SMILES | CC(=O)N[C@H]1[C@H]([C@@H]([C@H](O[C@H]1OC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)