CAS 76375-60-5 appears in our catalog under these names: D-Galactosamine pentaacetate, 97%, 2-Acetamido-2-deoxy-D-galactopyranose-1,3,4,6-tetra-O-acetate, >95% (HPLC), D–Galactosamine pentaacetate, 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-D-galactopyranose, D-Galactosamine pentaacetate 98%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 100g, 10g, 25g, 5g, 1g, 250mg, 50g, 500g.
[(2R,3R,4R,5R)-5-acetamido-3,4,6-triacetyloxyoxan-2-yl]methyl acetate (CAS 76375-60-5) is a chemical compound with the molecular formula C16H23NO10 and a molecular weight of 389.35 g/mol. IUPAC name: [(2R,3R,4R,5R)-5-acetamido-3,4,6-triacetyloxyoxan-2-yl]methyl acetate. InChIKey: OVPIZHVSWNOZMN-IWQYDBTJSA-N.
| Molecular formula | C16H23NO10 |
|---|---|
| Molecular weight | 389.35 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-5-acetamido-3,4,6-triacetyloxyoxan-2-yl]methyl acetate |
| InChIKey | OVPIZHVSWNOZMN-IWQYDBTJSA-N |
| SMILES | CC(=O)N[C@@H]1[C@H]([C@H]([C@H](OC1OC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)