cas: 1093651-96-7 — see every product listed under this CAS number, including other names
(2S,4R)-1-Fmoc-4-phenylpyrrolidine-2-carboxylic acid, 95%, 95% (CAS 1093651-96-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HBFT-50mg |
| cas | 1093651-96-7 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 544.40 Pln | |
| Chemat | 100mg | 832.40 Pln | |
| Chemat | 250mg | 1293.20 Pln | |
| Chemat | 1g | 3146.00 Pln | |
| Chemat | 5g | 9309.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-phenylpyrrolidine-2-carboxylic acid (CAS 1093651-96-7) is a chemical compound with the molecular formula C26H23NO4 and a molecular weight of 413.5 g/mol. IUPAC name: (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-phenylpyrrolidine-2-carboxylic acid. InChIKey: YABZSVAQRSIEAZ-UUOWRZLLSA-N.
| Molecular formula | C26H23NO4 |
|---|---|
| Molecular weight | 413.5 g/mol |
| IUPAC name | (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-phenylpyrrolidine-2-carboxylic acid |
| InChIKey | YABZSVAQRSIEAZ-UUOWRZLLSA-N |
| SMILES | C1[C@@H](CN([C@@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C5=CC=CC=C5 |
Computed by PubChem (NCBI)