CAS 269078-71-9 appears in our catalog under these names: (2S,4S)-Fmoc-4-phenyl-pyrrolidine-2-carboxylic acid, 97%, Fmoc-L-Pro(4-Ph)-OH (2S,4S), Fmoc-(2S,4S)-4-phenylpyrrolidine-2-carboxylic acid, Fmoc-Pro(4S-Ph)-OH 98%, (2S,4S)-Fmoc-4-Phenylpyrrolidine-2-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 5g, 250mg.
(2S,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-phenylpyrrolidine-2-carboxylic acid (CAS 269078-71-9) is a chemical compound with the molecular formula C26H23NO4 and a molecular weight of 413.5 g/mol. IUPAC name: (2S,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-phenylpyrrolidine-2-carboxylic acid. InChIKey: YABZSVAQRSIEAZ-KOSHJBKYSA-N.
| Molecular formula | C26H23NO4 |
|---|---|
| Molecular weight | 413.5 g/mol |
| IUPAC name | (2S,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-phenylpyrrolidine-2-carboxylic acid |
| InChIKey | YABZSVAQRSIEAZ-KOSHJBKYSA-N |
| SMILES | C1[C@H](CN([C@@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C5=CC=CC=C5 |
Computed by PubChem (NCBI)