cas: 1049734-21-5 — see every product listed under this CAS number, including other names
(2S,4R)-4-(4-Bromobenzyl)pyrrolidine-2-carboxylic acid hydrochloride, 95% (CAS 1049734-21-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F244261-100MG |
| cas | 1049734-21-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1783.76 Pln | |
| Fluorochem | 250mg | 2976.05 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2S,4R)-4-[(4-bromophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride (CAS 1049734-21-5) is a chemical compound with the molecular formula C12H15BrClNO2 and a molecular weight of 320.61 g/mol. IUPAC name: (2S,4R)-4-[(4-bromophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: PLADUNWTKKPQQP-XQKZEKTMSA-N.
| Molecular formula | C12H15BrClNO2 |
|---|---|
| Molecular weight | 320.61 g/mol |
| IUPAC name | (2S,4R)-4-[(4-bromophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | PLADUNWTKKPQQP-XQKZEKTMSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)CC2=CC=C(C=C2)Br.Cl |
Computed by PubChem (NCBI)