Products 2504201-39-0

CAS 2504201-39-0 is the registry number for (3-Bromo-5-chloro-phenyl)-methyl-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(3-bromo-5-chlorophenyl)-N-methylcarbamate (CAS 2504201-39-0) is a chemical compound with the molecular formula C12H15BrClNO2 and a molecular weight of 320.61 g/mol. IUPAC name: tert-butyl N-(3-bromo-5-chlorophenyl)-N-methylcarbamate. InChIKey: RDHKXPGKTYBXFQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15BrClNO2
Molecular weight320.61 g/mol
IUPAC nametert-butyl N-(3-bromo-5-chlorophenyl)-N-methylcarbamate
InChIKeyRDHKXPGKTYBXFQ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N(C)C1=CC(=CC(=C1)Br)Cl

Computed by PubChem (NCBI)