cas: 147267-15-0 — see every product listed under this CAS number, including other names
(2S,4R)-Boc-4-phenoxy-pyrrolidine-2-carboxylic acid, 96% (CAS 147267-15-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F493750-100MG |
| cas | 147267-15-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 456.11 Pln | |
| Fluorochem | 250mg | 726.85 Pln | |
| Fluorochem | 1g | 1565.09 Pln | |
| Fluorochem | 5g | 4569.24 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
(2S,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenoxypyrrolidine-2-carboxylic acid (CAS 147267-15-0) is a chemical compound with the molecular formula C16H21NO5 and a molecular weight of 307.34 g/mol. IUPAC name: (2S,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenoxypyrrolidine-2-carboxylic acid. InChIKey: IQFZJNCETIGXIO-OLZOCXBDSA-N.
| Molecular formula | C16H21NO5 |
|---|---|
| Molecular weight | 307.34 g/mol |
| IUPAC name | (2S,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenoxypyrrolidine-2-carboxylic acid |
| InChIKey | IQFZJNCETIGXIO-OLZOCXBDSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)O)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)