cas: 83623-93-2 — see every product listed under this CAS number, including other names
(2S,4S)–1–(tert–Butoxycarbonyl)–4–methoxypyrrolidine–2–carboxylic acid (CAS 83623-93-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB50842-100 |
| cas | 83623-93-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 568.96 Pln | |
| GLPBio | 10g | 6967.20 Pln | |
| GLPBio | 1g | 1533.14 Pln | |
| GLPBio | 250mg | 723.41 Pln | |
| GLPBio | 5g | 4346.12 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S,4S)-4-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 83623-93-2) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: (2S,4S)-4-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: COHIMMPWCAHSFN-YUMQZZPRSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | (2S,4S)-4-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | COHIMMPWCAHSFN-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)O)OC |
Computed by PubChem (NCBI)