cas: 83623-93-2 — see every product listed under this CAS number, including other names
(2S,4S)-1-(tert-Butoxycarbonyl)-4-methoxypyrrolidine-2-carboxylic acid, 98%, 98% (CAS 83623-93-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1167VT-50mg |
| cas | 83623-93-2 |
| size | 50mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 98.00 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 500mg | 285.20 Pln | |
| Chemat | 1g | 342.80 Pln | |
| Chemat | 5g | 1288.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S,4S)-4-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 83623-93-2) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: (2S,4S)-4-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: COHIMMPWCAHSFN-YUMQZZPRSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | (2S,4S)-4-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | COHIMMPWCAHSFN-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)O)OC |
Computed by PubChem (NCBI)