cas: 540501-56-2 — see every product listed under this CAS number, including other names
(2S,4S)-TERT-BUTYL 2-(HYDROXYMETHYL)-4-METHYLPYRROLIDINE-1-CARBOXYLATE (CAS 540501-56-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F472482-250MG |
| cas | 540501-56-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 909.07 Pln | |
| Fluorochem | 1g | 2486.64 Pln |
| delivery time | 2-3 weeks |
|---|
Tert-butyl (2S,4S)-2-(hydroxymethyl)-4-methylpyrrolidine-1-carboxylate (CAS 540501-56-2) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl (2S,4S)-2-(hydroxymethyl)-4-methylpyrrolidine-1-carboxylate. InChIKey: MTGCHOAIXJTLDT-IUCAKERBSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl (2S,4S)-2-(hydroxymethyl)-4-methylpyrrolidine-1-carboxylate |
| InChIKey | MTGCHOAIXJTLDT-IUCAKERBSA-N |
| SMILES | C[C@H]1C[C@H](N(C1)C(=O)OC(C)(C)C)CO |
Computed by PubChem (NCBI)