cas: 2253105-54-1 — see every product listed under this CAS number, including other names
(2S,4S)-tert-Butyl 4-amino-2-(hydroxymethyl)piperidine-1-carboxylate 97% (CAS 2253105-54-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A210764-250mg |
| cas | 2253105-54-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 2689.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A210764 |
Tert-butyl (2S,4S)-4-amino-2-(hydroxymethyl)piperidine-1-carboxylate (CAS 2253105-54-1) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: tert-butyl (2S,4S)-4-amino-2-(hydroxymethyl)piperidine-1-carboxylate. InChIKey: WASPQYKCAGLHMM-IUCAKERBSA-N.
| Molecular formula | C11H22N2O3 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | tert-butyl (2S,4S)-4-amino-2-(hydroxymethyl)piperidine-1-carboxylate |
| InChIKey | WASPQYKCAGLHMM-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C[C@H]1CO)N |
Computed by PubChem (NCBI)