Products 1163288-33-2

CAS 1163288-33-2 is the registry number for N-Isopropyl 2-(BOC-amino)propanamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[1-oxo-1-(propan-2-ylamino)propan-2-yl]carbamate (CAS 1163288-33-2) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: tert-butyl N-[1-oxo-1-(propan-2-ylamino)propan-2-yl]carbamate. InChIKey: ONGLMOYFXKVCRD-UHFFFAOYSA-N.

Identity
Molecular formulaC11H22N2O3
Molecular weight230.30 g/mol
IUPAC nametert-butyl N-[1-oxo-1-(propan-2-ylamino)propan-2-yl]carbamate
InChIKeyONGLMOYFXKVCRD-UHFFFAOYSA-N
SMILESCC(C)NC(=O)C(C)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)