cas: 790667-99-1 — see every product listed under this CAS number, including other names
(2S,4S)-tert-Butyl 4-hydroxy-2-methylpiperidine-1-carboxylate, 98+%, 98+% (CAS 790667-99-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G0AE-100mg |
| cas | 790667-99-1 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 500mg | 434.00 Pln | |
| Chemat | 1g | 698.00 Pln | |
| Chemat | 5g | 2267.60 Pln | |
| Chemat | 10g | 3784.40 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2S,4S)-4-hydroxy-2-methylpiperidine-1-carboxylate (CAS 790667-99-1) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl (2S,4S)-4-hydroxy-2-methylpiperidine-1-carboxylate. InChIKey: RCXJVQLRZJXWNM-IUCAKERBSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl (2S,4S)-4-hydroxy-2-methylpiperidine-1-carboxylate |
| InChIKey | RCXJVQLRZJXWNM-IUCAKERBSA-N |
| SMILES | C[C@H]1C[C@H](CCN1C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)