cas: 1262526-44-2 — see every product listed under this CAS number, including other names
(2S,4R)-4-(3-Fluorobenzyl)pyrrolidine-2-carboxylic acid, 98%, 98% (CAS 1262526-44-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111SEM-100mg |
| cas | 1262526-44-2 |
| size | 100mg |
| availability | 1.52g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 285.20 Pln | |
| Chemat | 1g | 938.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S,4R)-4-[(3-fluorophenyl)methyl]pyrrolidine-2-carboxylic acid (CAS 1262526-44-2) is a chemical compound with the molecular formula C12H14FNO2 and a molecular weight of 223.24 g/mol. IUPAC name: (2S,4R)-4-[(3-fluorophenyl)methyl]pyrrolidine-2-carboxylic acid. InChIKey: RGFRGRZSMVXTLF-KOLCDFICSA-N.
| Molecular formula | C12H14FNO2 |
|---|---|
| Molecular weight | 223.24 g/mol |
| IUPAC name | (2S,4R)-4-[(3-fluorophenyl)methyl]pyrrolidine-2-carboxylic acid |
| InChIKey | RGFRGRZSMVXTLF-KOLCDFICSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)CC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)