CAS 1262526-44-2 appears in our catalog under these names: (2S,4R)-4-(3-Fluorobenzyl)pyrrolidine-2-carboxylic acid, 95%, (2S,4R)-4-(3-Fluorobenzyl)pyrrolidine-2-carboxylic acid, 98%, (2S,4R)–4–(3–Fluorobenzyl)pyrrolidine–2–carboxylic acid, (2S,4R)-4-(3-Fluorobenzyl)pyrrolidine-2-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
(2S,4R)-4-[(3-fluorophenyl)methyl]pyrrolidine-2-carboxylic acid (CAS 1262526-44-2) is a chemical compound with the molecular formula C12H14FNO2 and a molecular weight of 223.24 g/mol. IUPAC name: (2S,4R)-4-[(3-fluorophenyl)methyl]pyrrolidine-2-carboxylic acid. InChIKey: RGFRGRZSMVXTLF-KOLCDFICSA-N.
| Molecular formula | C12H14FNO2 |
|---|---|
| Molecular weight | 223.24 g/mol |
| IUPAC name | (2S,4R)-4-[(3-fluorophenyl)methyl]pyrrolidine-2-carboxylic acid |
| InChIKey | RGFRGRZSMVXTLF-KOLCDFICSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)CC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)