cas: 596817-06-0 — see every product listed under this CAS number, including other names
(2S,4S)-1-(2-chloroacetyl)-4-fluoropyrrolidine-2-carbonitrile, 98%, 98% (CAS 596817-06-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11F3U6-100mg |
| cas | 596817-06-0 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1350.80 Pln | |
| Chemat | 250mg | 2210.00 Pln | |
| Chemat | 1g | 6717.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S,4S)-1-(2-chloroacetyl)-4-fluoropyrrolidine-2-carbonitrile (CAS 596817-06-0) is a chemical compound with the molecular formula C7H8ClFN2O and a molecular weight of 190.60 g/mol. IUPAC name: (2S,4S)-1-(2-chloroacetyl)-4-fluoropyrrolidine-2-carbonitrile. InChIKey: DMQSZIMWOFNPNR-WDSKDSINSA-N.
| Molecular formula | C7H8ClFN2O |
|---|---|
| Molecular weight | 190.60 g/mol |
| IUPAC name | (2S,4S)-1-(2-chloroacetyl)-4-fluoropyrrolidine-2-carbonitrile |
| InChIKey | DMQSZIMWOFNPNR-WDSKDSINSA-N |
| SMILES | C1[C@@H](CN([C@@H]1C#N)C(=O)CCl)F |
Computed by PubChem (NCBI)