CAS 1803593-88-5 is the registry number for 2-Fluorobenzohydrazide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
2-fluorobenzohydrazide;hydrochloride (CAS 1803593-88-5) is a chemical compound with the molecular formula C7H8ClFN2O and a molecular weight of 190.60 g/mol. IUPAC name: 2-fluorobenzohydrazide;hydrochloride. InChIKey: USHCUUCMYJSKKN-UHFFFAOYSA-N.
| Molecular formula | C7H8ClFN2O |
|---|---|
| Molecular weight | 190.60 g/mol |
| IUPAC name | 2-fluorobenzohydrazide;hydrochloride |
| InChIKey | USHCUUCMYJSKKN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NN)F.Cl |
Computed by PubChem (NCBI)