cas: 273399-94-3 — see every product listed under this CAS number, including other names
(2s)-2-Benzenesulfonamido-3-({[(9h-fluoren-9-yl)methoxy]carbonyl}amino)propanoic acid, 95% (CAS 273399-94-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F640154-100MG |
| cas | 273399-94-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 539.41 Pln | |
| Fluorochem | 250mg | 752.88 Pln | |
| Fluorochem | 1g | 1466.17 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-2-(benzenesulfonamido)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 273399-94-3) is a chemical compound with the molecular formula C24H22N2O6S and a molecular weight of 466.5 g/mol. IUPAC name: (2S)-2-(benzenesulfonamido)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: RJLJTSZSIHKGJS-QFIPXVFZSA-N.
| Molecular formula | C24H22N2O6S |
|---|---|
| Molecular weight | 466.5 g/mol |
| IUPAC name | (2S)-2-(benzenesulfonamido)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | RJLJTSZSIHKGJS-QFIPXVFZSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N[C@@H](CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)