Fmoc-(S)3-amino-2-(phenylsulfonylamino)propionic acid 95%
cas: 273399-94-3 — see every product listed under this CAS number, including other names
Fmoc-(S)3-amino-2-(phenylsulfonylamino)propionic acid 95% (CAS 273399-94-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A178281-100mg |
| cas | 273399-94-3 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1777.69 Pln | |
| Ambeed | 250mg | 2918.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A178281 |
(2S)-2-(benzenesulfonamido)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 273399-94-3) is a chemical compound with the molecular formula C24H22N2O6S and a molecular weight of 466.5 g/mol. IUPAC name: (2S)-2-(benzenesulfonamido)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: RJLJTSZSIHKGJS-QFIPXVFZSA-N.
| Molecular formula | C24H22N2O6S |
|---|---|
| Molecular weight | 466.5 g/mol |
| IUPAC name | (2S)-2-(benzenesulfonamido)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | RJLJTSZSIHKGJS-QFIPXVFZSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N[C@@H](CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)