(3,4-Bis(benzyloxy)phenyl)boronic acid, ≥95%
cas: 906665-98-3 — see every product listed under this CAS number, including other names
(3,4-Bis(benzyloxy)phenyl)boronic acid, ≥95% (CAS 906665-98-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12XF4X-100mg |
| cas | 906665-98-3 |
| size | 100mg |
| availability | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 318.80 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2680.40 Pln | |
| Fluorochem | 100mg | 367.60 Pln | |
| Fluorochem | 250mg | 570.65 Pln | |
| Fluorochem | 1g | 1393.28 Pln | |
| Fluorochem | 5g | 4964.94 Pln |
properties
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
[3,4-bis(phenylmethoxy)phenyl]boronic acid (CAS 906665-98-3) is a chemical compound with the molecular formula C20H19BO4 and a molecular weight of 334.2 g/mol. IUPAC name: [3,4-bis(phenylmethoxy)phenyl]boronic acid. InChIKey: NRFUTAIWNNLFDP-UHFFFAOYSA-N.
| Molecular formula | C20H19BO4 |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | [3,4-bis(phenylmethoxy)phenyl]boronic acid |
| InChIKey | NRFUTAIWNNLFDP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCC2=CC=CC=C2)OCC3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)