(3,4-Dichlorophenyl)-methanesulfonyl chloride
cas: 85952-30-3 — see every product listed under this CAS number, including other names
(3,4-Dichlorophenyl)-methanesulfonyl chloride (CAS 85952-30-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F013515-250MG |
| cas | 85952-30-3 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 351.98 Pln | |
| Fluorochem | 1g | 622.72 Pln | |
| Fluorochem | 2.5g | 1096.51 Pln | |
| Fluorochem | 5g | 2018.06 Pln | |
| Fluorochem | 10g | 3751.82 Pln |
properties
| delivery time | 2-3 weeks |
|---|
(3,4-dichlorophenyl)methanesulfonyl chloride (CAS 85952-30-3) is a chemical compound with the molecular formula C7H5Cl3O2S and a molecular weight of 259.5 g/mol. IUPAC name: (3,4-dichlorophenyl)methanesulfonyl chloride. InChIKey: DRYGYFAFCNDLEJ-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl3O2S |
|---|---|
| Molecular weight | 259.5 g/mol |
| IUPAC name | (3,4-dichlorophenyl)methanesulfonyl chloride |
| InChIKey | DRYGYFAFCNDLEJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CS(=O)(=O)Cl)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
(3,4-Dichlorophenyl)methanesulfonyl chloride, 3,4-dichlorophenylmethanesulfonyl chloride, (3,4-Dichloro-phenyl)-methanesulfonyl chloride, 3,4-Dichlorobenzylsulfonyl chloride, (3,4-Dichlorophenyl)-methanesulfonyl chloride, [(3,4-dichlorophenyl)methyl]sulfonyl chloride, benzenemethanesulfonyl chloride, 3,4-dichloro-, (3,4-Dichlorophenyl)methanesulphonyl chloride, [(3,4-dichlorophenyl)methyl]chlorosulfone, DRYGYFAFCNDLEJ-UHFFFAOYSA-N