Products 85952-30-3

CAS 85952-30-3 appears in our catalog under these names: (3,4-Dichloro-phenyl)-methanesulfonyl chloride, 97%, (3,4-Dichlorophenyl)methanesulfonyl chloride, 90% , (3,4-Dichlorophenyl)-methanesulfonyl chloride, 95%. Offered by: Combi-blocks, Thermo Scientific, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g, 250MG, 2.5g.

Structural formula: {0} (CAS {1})

(3,4-dichlorophenyl)methanesulfonyl chloride (CAS 85952-30-3) is a chemical compound with the molecular formula C7H5Cl3O2S and a molecular weight of 259.5 g/mol. IUPAC name: (3,4-dichlorophenyl)methanesulfonyl chloride. InChIKey: DRYGYFAFCNDLEJ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Cl3O2S
Molecular weight259.5 g/mol
IUPAC name(3,4-dichlorophenyl)methanesulfonyl chloride
InChIKeyDRYGYFAFCNDLEJ-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1CS(=O)(=O)Cl)Cl)Cl

Computed by PubChem (NCBI)