CAS 85952-30-3 appears in our catalog under these names: (3,4-Dichloro-phenyl)-methanesulfonyl chloride, 97%, (3,4-Dichlorophenyl)methanesulfonyl chloride, 90% , (3,4-Dichlorophenyl)-methanesulfonyl chloride, 95%. Offered by: Combi-blocks, Thermo Scientific, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g, 250MG, 2.5g.
(3,4-dichlorophenyl)methanesulfonyl chloride (CAS 85952-30-3) is a chemical compound with the molecular formula C7H5Cl3O2S and a molecular weight of 259.5 g/mol. IUPAC name: (3,4-dichlorophenyl)methanesulfonyl chloride. InChIKey: DRYGYFAFCNDLEJ-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl3O2S |
|---|---|
| Molecular weight | 259.5 g/mol |
| IUPAC name | (3,4-dichlorophenyl)methanesulfonyl chloride |
| InChIKey | DRYGYFAFCNDLEJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CS(=O)(=O)Cl)Cl)Cl |
Computed by PubChem (NCBI)