cas: 177735-55-6 — see every product listed under this CAS number, including other names
(3,5-Bis(methoxycarbonyl)phenyl)boronic acid, 95% (CAS 177735-55-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F226363-1G |
| cas | 177735-55-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 289.50 Pln | |
| Fluorochem | 10g | 445.69 Pln | |
| Fluorochem | 25g | 1028.82 Pln | |
| Fluorochem | 100g | 3923.64 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
[3,5-bis(methoxycarbonyl)phenyl]boronic acid (CAS 177735-55-6) is a chemical compound with the molecular formula C10H11BO6 and a molecular weight of 238.00 g/mol. IUPAC name: [3,5-bis(methoxycarbonyl)phenyl]boronic acid. InChIKey: WEJWFDLAZSVCJK-UHFFFAOYSA-N.
| Molecular formula | C10H11BO6 |
|---|---|
| Molecular weight | 238.00 g/mol |
| IUPAC name | [3,5-bis(methoxycarbonyl)phenyl]boronic acid |
| InChIKey | WEJWFDLAZSVCJK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(=O)OC)C(=O)OC)(O)O |
Computed by PubChem (NCBI)