(3,5-Bis(methoxycarbonyl)phenyl)boronic acid, 97%, 97%
cas: 177735-55-6 — see every product listed under this CAS number, including other names
(3,5-Bis(methoxycarbonyl)phenyl)boronic acid, 97%, 97% (CAS 177735-55-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1136I2-250mg |
| cas | 177735-55-6 |
| size | 250mg |
| availability | 110g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 203.60 Pln | |
| Chemat | 10g | 338.00 Pln | |
| Chemat | 25g | 722.00 Pln | |
| Chemat | 100g | 2354.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[3,5-bis(methoxycarbonyl)phenyl]boronic acid (CAS 177735-55-6) is a chemical compound with the molecular formula C10H11BO6 and a molecular weight of 238.00 g/mol. IUPAC name: [3,5-bis(methoxycarbonyl)phenyl]boronic acid. InChIKey: WEJWFDLAZSVCJK-UHFFFAOYSA-N.
| Molecular formula | C10H11BO6 |
|---|---|
| Molecular weight | 238.00 g/mol |
| IUPAC name | [3,5-bis(methoxycarbonyl)phenyl]boronic acid |
| InChIKey | WEJWFDLAZSVCJK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(=O)OC)C(=O)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3,5-Bis(methoxycarbonyl)phenylboronic acid, (3,5-Bis(methoxycarbonyl)phenyl)boronic acid, [3,5-Bis(methoxycarbonyl)phenyl]boronic acid, 3,5-Bis(methoxycarbonyl)benzeneboronic acid, 3,5-di(methoxycarbonyl)phenylboronic acid, WEJWFDLAZSVCJK-UHFFFAOYSA-N, (3,5-Bis(methoxycarbonyl)phenyl)boronicacid, [3,5-bis(methoxycarbonyl)phenyl]-dihydroxyborane