cas: 182344-15-6 — see every product listed under this CAS number, including other names
(3,5-Di-tert-butyl-4-hydroxyphenyl)boronic acid 97% (CAS 182344-15-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1150227-250mg |
| cas | 182344-15-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 348.12 Pln | |
| Ambeed | 1g | 604.00 Pln | |
| Ambeed | 5g | 2734.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1150227 |
(3,5-ditert-butyl-4-hydroxyphenyl)boronic acid (CAS 182344-15-6) is a chemical compound with the molecular formula C14H23BO3 and a molecular weight of 250.14 g/mol. IUPAC name: (3,5-ditert-butyl-4-hydroxyphenyl)boronic acid. InChIKey: WFMIGOJEPFFIHE-UHFFFAOYSA-N.
| Molecular formula | C14H23BO3 |
|---|---|
| Molecular weight | 250.14 g/mol |
| IUPAC name | (3,5-ditert-butyl-4-hydroxyphenyl)boronic acid |
| InChIKey | WFMIGOJEPFFIHE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)