cas: 182344-15-6 — see every product listed under this CAS number, including other names
(3,5-Di-tert-butyl-4-hydroxyphenyl)boronic acid, 98%, 98% (CAS 182344-15-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KK74-100mg |
| cas | 182344-15-6 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 506.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3,5-ditert-butyl-4-hydroxyphenyl)boronic acid (CAS 182344-15-6) is a chemical compound with the molecular formula C14H23BO3 and a molecular weight of 250.14 g/mol. IUPAC name: (3,5-ditert-butyl-4-hydroxyphenyl)boronic acid. InChIKey: WFMIGOJEPFFIHE-UHFFFAOYSA-N.
| Molecular formula | C14H23BO3 |
|---|---|
| Molecular weight | 250.14 g/mol |
| IUPAC name | (3,5-ditert-butyl-4-hydroxyphenyl)boronic acid |
| InChIKey | WFMIGOJEPFFIHE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)