cas: 1072951-59-7 — see every product listed under this CAS number, including other names
(3,5-Diiodo-2-methoxyphenyl)boronic acid, 97% (CAS 1072951-59-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A140344-250mg |
| cas | 1072951-59-7 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 239.26 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3,5-diiodo-2-methoxyphenyl)boronic acid (CAS 1072951-59-7) is a chemical compound with the molecular formula C7H7BI2O3 and a molecular weight of 403.75 g/mol. IUPAC name: (3,5-diiodo-2-methoxyphenyl)boronic acid. InChIKey: GLXUCKYNVDXHBW-UHFFFAOYSA-N.
| Molecular formula | C7H7BI2O3 |
|---|---|
| Molecular weight | 403.75 g/mol |
| IUPAC name | (3,5-diiodo-2-methoxyphenyl)boronic acid |
| InChIKey | GLXUCKYNVDXHBW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OC)I)I)(O)O |
Computed by PubChem (NCBI)