Products 1072951-59-7

CAS 1072951-59-7 appears in our catalog under these names: 3,5-Diiodo-2-methoxyphenylboronic acid, 97%, (3,5-Diiodo-2-methoxyphenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

(3,5-diiodo-2-methoxyphenyl)boronic acid (CAS 1072951-59-7) is a chemical compound with the molecular formula C7H7BI2O3 and a molecular weight of 403.75 g/mol. IUPAC name: (3,5-diiodo-2-methoxyphenyl)boronic acid. InChIKey: GLXUCKYNVDXHBW-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BI2O3
Molecular weight403.75 g/mol
IUPAC name(3,5-diiodo-2-methoxyphenyl)boronic acid
InChIKeyGLXUCKYNVDXHBW-UHFFFAOYSA-N
SMILESB(C1=CC(=CC(=C1OC)I)I)(O)O

Computed by PubChem (NCBI)