cas: 849762-24-9 — see every product listed under this CAS number, including other names
(3,6-Dioxocyclohexa-1,4-dien-1-yl)methyl 3-methylbutanoate, 97% (CAS 849762-24-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211139-100MG |
| cas | 849762-24-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 299.91 Pln | |
| Fluorochem | 250mg | 529.00 Pln | |
| Fluorochem | 1g | 1471.37 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(3,6-dioxocyclohexa-1,4-dien-1-yl)methyl 3-methylbutanoate (CAS 849762-24-9) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: (3,6-dioxocyclohexa-1,4-dien-1-yl)methyl 3-methylbutanoate. InChIKey: JVMUMZYOAWLJQW-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | (3,6-dioxocyclohexa-1,4-dien-1-yl)methyl 3-methylbutanoate |
| InChIKey | JVMUMZYOAWLJQW-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)OCC1=CC(=O)C=CC1=O |
Computed by PubChem (NCBI)