Products 1314763-76-2
CAS 1314763-76-2 appears in our catalog under these names: 1-(2,4-Dimethoxyphenyl)cyclopropanecarboxylic acid, 95%, 1-(2,4-Dimethoxyphenyl)cyclopropanecarboxylic Acid, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g.
1-(2,4-dimethoxyphenyl)cyclopropane-1-carboxylic acid (CAS 1314763-76-2) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 1-(2,4-dimethoxyphenyl)cyclopropane-1-carboxylic acid. InChIKey: GOOSRQYGRHGCPV-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 1-(2,4-dimethoxyphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | GOOSRQYGRHGCPV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2(CC2)C(=O)O)OC |
Computed by PubChem (NCBI)