cas: 459423-32-6 — see every product listed under this CAS number, including other names
(3–(Adamantan–1–yl)–4–methoxyphenyl)boronic acid (CAS 459423-32-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF52732-100mg |
| cas | 459423-32-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 526.83 Pln | |
| GLPBio | 1g | 831.06 Pln | |
| GLPBio | 250mg | 583.00 Pln | |
| GLPBio | 5g | 1753.12 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
[3-(1-adamantyl)-4-methoxyphenyl]boronic acid (CAS 459423-32-6) is a chemical compound with the molecular formula C17H23BO3 and a molecular weight of 286.2 g/mol. IUPAC name: [3-(1-adamantyl)-4-methoxyphenyl]boronic acid. InChIKey: FPZOBRFHRPQGAA-UHFFFAOYSA-N.
| Molecular formula | C17H23BO3 |
|---|---|
| Molecular weight | 286.2 g/mol |
| IUPAC name | [3-(1-adamantyl)-4-methoxyphenyl]boronic acid |
| InChIKey | FPZOBRFHRPQGAA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC)C23CC4CC(C2)CC(C4)C3)(O)O |
Computed by PubChem (NCBI)