cas: 459423-32-6 — see every product listed under this CAS number, including other names
3-(1-Adamantyl)-4-methoxyphenylboronic acid, 97% (CAS 459423-32-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F045253-250MG |
| cas | 459423-32-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 487.35 Pln | |
| Fluorochem | 5g | 2158.63 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[3-(1-adamantyl)-4-methoxyphenyl]boronic acid (CAS 459423-32-6) is a chemical compound with the molecular formula C17H23BO3 and a molecular weight of 286.2 g/mol. IUPAC name: [3-(1-adamantyl)-4-methoxyphenyl]boronic acid. InChIKey: FPZOBRFHRPQGAA-UHFFFAOYSA-N.
| Molecular formula | C17H23BO3 |
|---|---|
| Molecular weight | 286.2 g/mol |
| IUPAC name | [3-(1-adamantyl)-4-methoxyphenyl]boronic acid |
| InChIKey | FPZOBRFHRPQGAA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC)C23CC4CC(C2)CC(C4)C3)(O)O |
Computed by PubChem (NCBI)