cas: 874459-99-1 — see every product listed under this CAS number, including other names
(3-((4-Methoxyphenyl)carbamoyl)phenyl)boronic acid, 95% (CAS 874459-99-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F776747-250MG |
| cas | 874459-99-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1502.61 Pln | |
| Fluorochem | 1g | 3278.03 Pln | |
| Fluorochem | 5g | 8635.52 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
[3-[(4-methoxyphenyl)carbamoyl]phenyl]boronic acid (CAS 874459-99-1) is a chemical compound with the molecular formula C14H14BNO4 and a molecular weight of 271.08 g/mol. IUPAC name: [3-[(4-methoxyphenyl)carbamoyl]phenyl]boronic acid. InChIKey: CAYFIPXETZSTMI-UHFFFAOYSA-N.
| Molecular formula | C14H14BNO4 |
|---|---|
| Molecular weight | 271.08 g/mol |
| IUPAC name | [3-[(4-methoxyphenyl)carbamoyl]phenyl]boronic acid |
| InChIKey | CAYFIPXETZSTMI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NC2=CC=C(C=C2)OC)(O)O |
Computed by PubChem (NCBI)