Products 874459-99-1
CAS 874459-99-1 appears in our catalog under these names: 3-(4-methoxyphenylcarbamoyl)phenylboronic acid, 95%, (3-((4-methoxyphenyl)carbamoyl)phenyl)boronic acid, 95+%, (3–((4–Methoxyphenyl)carbamoyl)phenyl)boronic acid, (3-((4-Methoxyphenyl)carbamoyl)phenyl)boronic acid, 95%, 95%, (3-((4-Methoxyphenyl)carbamoyl)phenyl)boronic acid, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
[3-[(4-methoxyphenyl)carbamoyl]phenyl]boronic acid (CAS 874459-99-1) is a chemical compound with the molecular formula C14H14BNO4 and a molecular weight of 271.08 g/mol. IUPAC name: [3-[(4-methoxyphenyl)carbamoyl]phenyl]boronic acid. InChIKey: CAYFIPXETZSTMI-UHFFFAOYSA-N.
| Molecular formula | C14H14BNO4 |
|---|---|
| Molecular weight | 271.08 g/mol |
| IUPAC name | [3-[(4-methoxyphenyl)carbamoyl]phenyl]boronic acid |
| InChIKey | CAYFIPXETZSTMI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NC2=CC=C(C=C2)OC)(O)O |
Computed by PubChem (NCBI)