(3-((Dimethylamino)methyl)phenyl)boronic acid hydrochloride, 97%, 97%
cas: 1485417-01-3 — see every product listed under this CAS number, including other names
(3-((Dimethylamino)methyl)phenyl)boronic acid hydrochloride, 97%, 97% (CAS 1485417-01-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112KZL-100mg |
| cas | 1485417-01-3 |
| size | 100mg |
| availability | 30g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 544.40 Pln | |
| Chemat | 10g | 1029.20 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[3-[(dimethylamino)methyl]phenyl]boronic acid;hydrochloride (CAS 1485417-01-3) is a chemical compound with the molecular formula C9H15BClNO2 and a molecular weight of 215.49 g/mol. IUPAC name: [3-[(dimethylamino)methyl]phenyl]boronic acid;hydrochloride. InChIKey: NLTVXNFNTNAFSL-UHFFFAOYSA-N.
| Molecular formula | C9H15BClNO2 |
|---|---|
| Molecular weight | 215.49 g/mol |
| IUPAC name | [3-[(dimethylamino)methyl]phenyl]boronic acid;hydrochloride |
| InChIKey | NLTVXNFNTNAFSL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)CN(C)C)(O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
(3-((Dimethylamino)methyl)phenyl)boronic acid hydrochloride, 3-((Dimethylamino)methyl)phenylboronic acid hydrochloride, {3-[(dimethylamino)methyl]phenyl}boronic acid hydrochloride, [3-[(dimethylamino)methyl]phenyl]boronic acid;hydrochloride, 3-((diMethylaMino)Methyl)phenylboronic acid HCL, (3-[(Dimethylamino)methyl]phenyl)boronic acid hydrochloride, 3-dimethylamine methyobboric acid, (3-((Dimethylamino)methyl)phenyl)boronicacidhydrochloride