CAS 1485417-01-3 appears in our catalog under these names: {3-((Dimethylamino)methyl)phenyl}boronic acid hydrochloride, 3-((Dimethylamino)methyl)phenylboronic acid hydrochloride, 97%, (3-[(Dimethylamino)methyl]phenyl)boronic acid hydrochloride, 95%, (3-((Dimethylamino)methyl)phenyl)boronic acid hydrochloride 97%, (3-((Dimethylamino)methyl)phenyl)boronic acid hydrochloride, 97%, 97%. Offered by: Biosynth, Fluorochem, Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg.
[3-[(dimethylamino)methyl]phenyl]boronic acid;hydrochloride (CAS 1485417-01-3) is a chemical compound with the molecular formula C9H15BClNO2 and a molecular weight of 215.49 g/mol. IUPAC name: [3-[(dimethylamino)methyl]phenyl]boronic acid;hydrochloride. InChIKey: NLTVXNFNTNAFSL-UHFFFAOYSA-N.
| Molecular formula | C9H15BClNO2 |
|---|---|
| Molecular weight | 215.49 g/mol |
| IUPAC name | [3-[(dimethylamino)methyl]phenyl]boronic acid;hydrochloride |
| InChIKey | NLTVXNFNTNAFSL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)CN(C)C)(O)O.Cl |
Computed by PubChem (NCBI)