cas: 871329-57-6 — see every product listed under this CAS number, including other names
(3-((tert-Butoxycarbonyl)amino)-4-chlorophenyl)boronic acid 97% (CAS 871329-57-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A260735-100mg |
| cas | 871329-57-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 337.00 Pln | |
| Ambeed | 250mg | 537.25 Pln | |
| Ambeed | 1g | 1143.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A260735 |
[4-chloro-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid (CAS 871329-57-6) is a chemical compound with the molecular formula C11H15BClNO4 and a molecular weight of 271.51 g/mol. IUPAC name: [4-chloro-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid. InChIKey: YDGKXXRWQFCXOO-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO4 |
|---|---|
| Molecular weight | 271.51 g/mol |
| IUPAC name | [4-chloro-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
| InChIKey | YDGKXXRWQFCXOO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)NC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)